C9H16F4O2 — CID 95757070
1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethoxy]butane (PubChem CID 95757070) has the molecular formula C9H16F4O2 and a molecular weight of 232.22 g/mol. Its IUPAC name is 1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethoxy]butane.
| Compound Name | 1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethoxy]butane |
|---|---|
| PubChem CID | 95757070 |
| Molecular Formula | C9H16F4O2 |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-[(1S)-1-(2,2,3,3-tetrafluoropropoxy)ethoxy]butane |
| SMILES | CCCCO[C@H](C)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H16F4O2/c1-3-4-5-14-7(2)15-6-9(12,13)8(10)11/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | UFSXRGGZOLVUPF-ZETCQYMHSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|