C32H26F28O3Sn2 — CID 23115073
[bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannane (PubChem CID 23115073) has the molecular formula C32H26F28O3Sn2 and a molecular weight of 1227.92 g/mol. Its IUPAC name is [bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannane.
| Compound Name | [bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannane |
|---|---|
| PubChem CID | 23115073 |
| Molecular Formula | C32H26F28O3Sn2 |
| Molecular Weight | 1227.92 g/mol |
| Exact Mass | 1229.95 |
| IUPAC Name | [bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-(1-phenylethoxy)stannane |
| SMILES | CC(O[Sn](O[Sn](OC(C)c1ccccc1)(C(F)(F)C(F)(F)C(F)(F)CF)C(F)(F)C(F)(F)C(F)(F)CF)(C(F)(F)C(F)(F)C(F)(F)CF)C(F)(F)C(F)(F)C(F)(F)CF)c1ccccc1 |
| InChI | InChI=1S/2C8H9O.4C4H2F7.O.2Sn/c2*1-7(9)8-5-3-2-4-6-8;4*5-1-3(8,9)4(10,11)2(6)7;;;/h2*2-7H,1H3;4*1H2;;;/q2*-1;;;;;;2*+1 |
| InChIKey | SHUDQDOQLGSOER-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.92 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|