C24H22F8O2 — CID 91163968
methyl hypofluorite;(2,2,3-trifluoro-1,1-diphenylpropyl)benzene;1,1,2-trifluoroethyl hypofluorite (PubChem CID 91163968) has the molecular formula C24H22F8O2 and a molecular weight of 494.42 g/mol. Its IUPAC name is methyl hypofluorite;(2,2,3-trifluoro-1,1-diphenylpropyl)benzene;1,1,2-trifluoroethyl hypofluorite.
| Compound Name | methyl hypofluorite;(2,2,3-trifluoro-1,1-diphenylpropyl)benzene;1,1,2-trifluoroethyl hypofluorite |
|---|---|
| PubChem CID | 91163968 |
| Molecular Formula | C24H22F8O2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | methyl hypofluorite;(2,2,3-trifluoro-1,1-diphenylpropyl)benzene;1,1,2-trifluoroethyl hypofluorite |
| SMILES | COF.FCC(F)(F)C(c1ccccc1)(c1ccccc1)c1ccccc1.FCC(F)(F)OF |
| InChI | InChI=1S/C21H17F3.C2H2F4O.CH3FO/c22-16-20(23,24)21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;3-1-2(4,5)7-6;1-3-2/h1-15H,16H2;1H2;1H3 |
| InChIKey | DYNFCEYYWIBYMO-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|