C10H16Cl2F6OSi — CID 88739785
butyl-dichloro-(1,2,2,3,3,3-hexafluoro-1-propoxypropyl)silane (PubChem CID 88739785) has the molecular formula C10H16Cl2F6OSi and a molecular weight of 365.22 g/mol. Its IUPAC name is butyl-dichloro-(1,2,2,3,3,3-hexafluoro-1-propoxypropyl)silane.
| Compound Name | butyl-dichloro-(1,2,2,3,3,3-hexafluoro-1-propoxypropyl)silane |
|---|---|
| PubChem CID | 88739785 |
| Molecular Formula | C10H16Cl2F6OSi |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | butyl-dichloro-(1,2,2,3,3,3-hexafluoro-1-propoxypropyl)silane |
| SMILES | CCCC[Si](Cl)(Cl)C(F)(OCCC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16Cl2F6OSi/c1-3-5-7-20(11,12)10(18,19-6-4-2)8(13,14)9(15,16)17/h3-7H2,1-2H3 |
| InChIKey | GMPMGKHCXFDETK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|