C8H2F16O — CID 156806377
1,1,1,2,2,4,4,4-octafluoro-3-(2,2,3,3,3-pentafluoropropoxy)-3-(trifluoromethyl)butane (PubChem CID 156806377) has the molecular formula C8H2F16O and a molecular weight of 418.07 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,4-octafluoro-3-(2,2,3,3,3-pentafluoropropoxy)-3-(trifluoromethyl)butane.
| Compound Name | 1,1,1,2,2,4,4,4-octafluoro-3-(2,2,3,3,3-pentafluoropropoxy)-3-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 156806377 |
| Molecular Formula | C8H2F16O |
| Molecular Weight | 418.07 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 1,1,1,2,2,4,4,4-octafluoro-3-(2,2,3,3,3-pentafluoropropoxy)-3-(trifluoromethyl)butane |
| SMILES | FC(F)(F)C(F)(F)COC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16O/c9-2(10,5(13,14)15)1-25-3(6(16,17)18,7(19,20)21)4(11,12)8(22,23)24/h1H2 |
| InChIKey | ZDASYELNYGTLBW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|