C2H2ClF2LiO2 — CID 173193324
lithium;2-chloro-2,2-difluoroacetic acid;hydride (PubChem CID 173193324) has the molecular formula C2H2ClF2LiO2 and a molecular weight of 138.43 g/mol. Its IUPAC name is lithium;2-chloro-2,2-difluoroacetic acid;hydride.
| Compound Name | lithium;2-chloro-2,2-difluoroacetic acid;hydride |
|---|---|
| PubChem CID | 173193324 |
| Molecular Formula | C2H2ClF2LiO2 |
| Molecular Weight | 138.43 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | lithium;2-chloro-2,2-difluoroacetic acid;hydride |
| SMILES | O=C(O)C(F)(F)Cl.[H-].[Li+] |
| InChI | InChI=1S/C2HClF2O2.Li.H/c3-2(4,5)1(6)7;;/h(H,6,7);;/q;+1;-1 |
| InChIKey | YEJGOVGNJQNPRZ-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.43 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|