C8F16O4S — CID 11038354
1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2,3,3-pentafluorocyclopropyl)oxypropan-2-yl]oxyethanesulfonyl fluoride (PubChem CID 11038354) has the molecular formula C8F16O4S and a molecular weight of 496.12 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2,3,3-pentafluorocyclopropyl)oxypropan-2-yl]oxyethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2,3,3-pentafluorocyclopropyl)oxypropan-2-yl]oxyethanesulfonyl fluoride |
|---|---|
| PubChem CID | 11038354 |
| Molecular Formula | C8F16O4S |
| Molecular Weight | 496.12 g/mol |
| Exact Mass | 495.93 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2,3,3-pentafluorocyclopropyl)oxypropan-2-yl]oxyethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC1(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F16O4S/c9-1(10)2(11,12)3(1,13)27-6(18,19)4(14,5(15,16)17)28-7(20,21)8(22,23)29(24,25)26 |
| InChIKey | RXKQLJUNVKZIPS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.12 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|