C8HCl6F11 — CID 154298339
1,2,4,6,8,8-hexachloro-1,1,2,3,3,4,5,5,6,7,7-undecafluorooctane (PubChem CID 154298339) has the molecular formula C8HCl6F11 and a molecular weight of 518.79 g/mol. Its IUPAC name is 1,2,4,6,8,8-hexachloro-1,1,2,3,3,4,5,5,6,7,7-undecafluorooctane.
| Compound Name | 1,2,4,6,8,8-hexachloro-1,1,2,3,3,4,5,5,6,7,7-undecafluorooctane |
|---|---|
| PubChem CID | 154298339 |
| Molecular Formula | C8HCl6F11 |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 515.80 |
| IUPAC Name | 1,2,4,6,8,8-hexachloro-1,1,2,3,3,4,5,5,6,7,7-undecafluorooctane |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(Cl)Cl |
| InChI | InChI=1S/C8HCl6F11/c9-1(10)2(15,16)3(11,17)6(20,21)4(12,18)7(22,23)5(13,19)8(14,24)25/h1H |
| InChIKey | SSFVOLDGZHHVFV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|