C10BrCl6F15 — CID 154256396
9-bromo-1,1,3,5,7,10-hexachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane (PubChem CID 154256396) has the molecular formula C10BrCl6F15 and a molecular weight of 697.70 g/mol. Its IUPAC name is 9-bromo-1,1,3,5,7,10-hexachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane.
| Compound Name | 9-bromo-1,1,3,5,7,10-hexachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane |
|---|---|
| PubChem CID | 154256396 |
| Molecular Formula | C10BrCl6F15 |
| Molecular Weight | 697.70 g/mol |
| Exact Mass | 693.71 |
| IUPAC Name | 9-bromo-1,1,3,5,7,10-hexachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane |
| SMILES | FC(F)(Cl)C(F)(Br)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C10BrCl6F15/c11-1(18,10(17,31)32)5(22,23)2(12,19)6(24,25)3(13,20)7(26,27)4(14,21)8(28,29)9(15,16)30 |
| InChIKey | JEKDZWCYWCLPLJ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.70 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|