C4H2Cl2F8 — CID 160658903
chloro(difluoro)methane;1-chloro-1,1,2,2,3,3-hexafluoropropane (PubChem CID 160658903) has the molecular formula C4H2Cl2F8 and a molecular weight of 272.95 g/mol. Its IUPAC name is chloro(difluoro)methane;1-chloro-1,1,2,2,3,3-hexafluoropropane.
| Compound Name | chloro(difluoro)methane;1-chloro-1,1,2,2,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 160658903 |
| Molecular Formula | C4H2Cl2F8 |
| Molecular Weight | 272.95 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | chloro(difluoro)methane;1-chloro-1,1,2,2,3,3-hexafluoropropane |
| SMILES | FC(F)C(F)(F)C(F)(F)Cl.FC(F)Cl |
| InChI | InChI=1S/C3HClF6.CHClF2/c4-3(9,10)2(7,8)1(5)6;2-1(3)4/h1H;1H |
| InChIKey | RLKHXMGFQBJWAW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|