C5H4Br2Cl2F4 — CID 119097133
1,5-dibromo-3,3-dichloro-1,1,2,2-tetrafluoropentane (PubChem CID 119097133) has the molecular formula C5H4Br2Cl2F4 and a molecular weight of 370.79 g/mol. Its IUPAC name is 1,5-dibromo-3,3-dichloro-1,1,2,2-tetrafluoropentane.
| Compound Name | 1,5-dibromo-3,3-dichloro-1,1,2,2-tetrafluoropentane |
|---|---|
| PubChem CID | 119097133 |
| Molecular Formula | C5H4Br2Cl2F4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 367.80 |
| IUPAC Name | 1,5-dibromo-3,3-dichloro-1,1,2,2-tetrafluoropentane |
| SMILES | FC(F)(Br)C(F)(F)C(Cl)(Cl)CCBr |
| InChI | InChI=1S/C5H4Br2Cl2F4/c6-2-1-3(8,9)4(10,11)5(7,12)13/h1-2H2 |
| InChIKey | FPNZIAZISWMZHV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|