C6H6ClF7 — CID 154321348
4-chloro-1,1,1,2,2,3,3-heptafluoro-4-methylpentane (PubChem CID 154321348) has the molecular formula C6H6ClF7 and a molecular weight of 246.55 g/mol. Its IUPAC name is 4-chloro-1,1,1,2,2,3,3-heptafluoro-4-methylpentane.
| Compound Name | 4-chloro-1,1,1,2,2,3,3-heptafluoro-4-methylpentane |
|---|---|
| PubChem CID | 154321348 |
| Molecular Formula | C6H6ClF7 |
| Molecular Weight | 246.55 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 4-chloro-1,1,1,2,2,3,3-heptafluoro-4-methylpentane |
| SMILES | CC(C)(Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6ClF7/c1-3(2,7)4(8,9)5(10,11)6(12,13)14/h1-2H3 |
| InChIKey | DLCBBWJQLMRVSV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|