C3Br3F5 — CID 15186175
1,1,3-tribromo-1,2,2,3,3-pentafluoropropane (PubChem CID 15186175) has the molecular formula C3Br3F5 and a molecular weight of 370.74 g/mol. Its IUPAC name is 1,1,3-tribromo-1,2,2,3,3-pentafluoropropane.
| Compound Name | 1,1,3-tribromo-1,2,2,3,3-pentafluoropropane |
|---|---|
| PubChem CID | 15186175 |
| Molecular Formula | C3Br3F5 |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 367.75 |
| IUPAC Name | 1,1,3-tribromo-1,2,2,3,3-pentafluoropropane |
| SMILES | FC(F)(Br)C(F)(F)C(F)(Br)Br |
| InChI | InChI=1S/C3Br3F5/c4-2(5,9)1(7,8)3(6,10)11 |
| InChIKey | SBBHMWCPPPDEME-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|