C8Br3F12N — CID 98117638
(3R,5R)-3,5,8-tribromo-2,2,3,4,4,5,6,6,7,7,8,8-dodecafluorooctanenitrile (PubChem CID 98117638) has the molecular formula C8Br3F12N and a molecular weight of 577.78 g/mol. Its IUPAC name is (3R,5R)-3,5,8-tribromo-2,2,3,4,4,5,6,6,7,7,8,8-dodecafluorooctanenitrile.
| Compound Name | (3R,5R)-3,5,8-tribromo-2,2,3,4,4,5,6,6,7,7,8,8-dodecafluorooctanenitrile |
|---|---|
| PubChem CID | 98117638 |
| Molecular Formula | C8Br3F12N |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 574.74 |
| IUPAC Name | (3R,5R)-3,5,8-tribromo-2,2,3,4,4,5,6,6,7,7,8,8-dodecafluorooctanenitrile |
| SMILES | N#CC(F)(F)[C@@](F)(Br)C(F)(F)[C@](F)(Br)C(F)(F)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C8Br3F12N/c9-3(14,2(12,13)1-24)5(16,17)4(10,15)6(18,19)7(20,21)8(11,22)23/t3-,4+/m0/s1 |
| InChIKey | UCYGXOAVOVSJQS-IUYQGCFVSA-N |
| XLogP | 6.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|