C7F12 — CID 46898415
1,1,1,4,4,5,5,6,6,7,7,7-dodecafluorohept-2-yne (PubChem CID 46898415) has the molecular formula C7F12 and a molecular weight of 312.05 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,6,6,7,7,7-dodecafluorohept-2-yne.
| Compound Name | 1,1,1,4,4,5,5,6,6,7,7,7-dodecafluorohept-2-yne |
|---|---|
| PubChem CID | 46898415 |
| Molecular Formula | C7F12 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 1,1,1,4,4,5,5,6,6,7,7,7-dodecafluorohept-2-yne |
| SMILES | FC(F)(F)C#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F12/c8-3(9,1-2-4(10,11)12)5(13,14)6(15,16)7(17,18)19 |
| InChIKey | SQMLILQCVWKPLX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|