C8F12 — CID 178077881
1,1,1,4,4,4-hexafluorobut-2-yne (PubChem CID 178077881) has the molecular formula C8F12 and a molecular weight of 324.06 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobut-2-yne.
| Compound Name | 1,1,1,4,4,4-hexafluorobut-2-yne |
|---|---|
| PubChem CID | 178077881 |
| Molecular Formula | C8F12 |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobut-2-yne |
| SMILES | FC(F)(F)C#CC(F)(F)F.FC(F)(F)C#CC(F)(F)F |
| InChI | InChI=1S/2C4F6/c2*5-3(6,7)1-2-4(8,9)10 |
| InChIKey | VYAOEDJKUMJKLD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|