C12F12Si — CID 91719489
tetrakis(3,3,3-trifluoroprop-1-ynyl)silane (PubChem CID 91719489) has the molecular formula C12F12Si and a molecular weight of 400.19 g/mol. Its IUPAC name is tetrakis(3,3,3-trifluoroprop-1-ynyl)silane.
| Compound Name | tetrakis(3,3,3-trifluoroprop-1-ynyl)silane |
|---|---|
| PubChem CID | 91719489 |
| Molecular Formula | C12F12Si |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | tetrakis(3,3,3-trifluoroprop-1-ynyl)silane |
| SMILES | FC(F)(F)C#C[Si](C#CC(F)(F)F)(C#CC(F)(F)F)C#CC(F)(F)F |
| InChI | InChI=1S/C12F12Si/c13-9(14,15)1-5-25(6-2-10(16,17)18,7-3-11(19,20)21)8-4-12(22,23)24 |
| InChIKey | UMVDWTFDRMQBOS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|