C9H3Cl2F3 — CID 56958304
1,2-dichloro-4-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 56958304) has the molecular formula C9H3Cl2F3 and a molecular weight of 239.02 g/mol. Its IUPAC name is 1,2-dichloro-4-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 1,2-dichloro-4-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 56958304 |
| Molecular Formula | C9H3Cl2F3 |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 1,2-dichloro-4-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | FC(F)(F)C#Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H3Cl2F3/c10-7-2-1-6(5-8(7)11)3-4-9(12,13)14/h1-2,5H |
| InChIKey | NLZOKRXPJBYKQM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|