C8H3Cl2IS — CID 134179440
2-(3,4-dichlorophenyl)ethynyl thiohypoiodite (PubChem CID 134179440) has the molecular formula C8H3Cl2IS and a molecular weight of 328.99 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)ethynyl thiohypoiodite.
| Compound Name | 2-(3,4-dichlorophenyl)ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 134179440 |
| Molecular Formula | C8H3Cl2IS |
| Molecular Weight | 328.99 g/mol |
| Exact Mass | 327.84 |
| IUPAC Name | 2-(3,4-dichlorophenyl)ethynyl thiohypoiodite |
| SMILES | Clc1ccc(C#CSI)cc1Cl |
| InChI | InChI=1S/C8H3Cl2IS/c9-7-2-1-6(3-4-12-11)5-8(7)10/h1-2,5H |
| InChIKey | ATBSJIJOBQJQNY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.99 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|