About 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite
2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite (PubChem CID 143999673) has the molecular formula C14H4Cl2I2S2
and a molecular weight of 561.03 g/mol. Its IUPAC name is 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite.
Molecular Properties
| Compound Name | 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite |
| PubChem CID | 143999673 |
| Molecular Formula | C14H4Cl2I2S2 |
| Molecular Weight | 561.03 g/mol |
| Exact Mass | 559.72 |
| IUPAC Name | 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite |
| SMILES | Clc1c(C#CSI)ccc2c(Cl)c(C#CSI)ccc12 |
| InChI | InChI=1S/C14H4Cl2I2S2/c15-13-9(5-7-19-17)1-3-11-12(13)4-2-10(14(11)16)6-8-20-18/h1-4H |
| InChIKey | IPQOHTRGIZIHJU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.03 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite?
The IUPAC name of 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite (CID 143999673) is 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite.
What is the SMILES notation for 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite?
The canonical SMILES for 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite is Clc1c(C#CSI)ccc2c(Cl)c(C#CSI)ccc12.
What is the InChIKey of 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite?
The InChIKey is IPQOHTRGIZIHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H4Cl2I2S2/c15-13-9(5-7-19-17)1-3-11-12(13)4-2-10(14(11)16)6-8-20-18/h1-4H.
What are the key properties of 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite?
2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite has a molecular weight of 561.03 g/mol, XLogP of 6.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,5-dichloro-6-(2-iodosulfanylethynyl)naphthalen-2-yl]ethynyl thiohypoiodite is sourced from PubChem (CID 143999673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).