C24H12Cl2F3N — CID 150846477
2-[3-[2-(3,4-dichlorophenyl)ethynyl]phenyl]-8-(trifluoromethyl)quinoline (PubChem CID 150846477) has the molecular formula C24H12Cl2F3N and a molecular weight of 442.27 g/mol. Its IUPAC name is 2-[3-[2-(3,4-dichlorophenyl)ethynyl]phenyl]-8-(trifluoromethyl)quinoline.
| Compound Name | 2-[3-[2-(3,4-dichlorophenyl)ethynyl]phenyl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 150846477 |
| Molecular Formula | C24H12Cl2F3N |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-[3-[2-(3,4-dichlorophenyl)ethynyl]phenyl]-8-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cccc2ccc(-c3cccc(C#Cc4ccc(Cl)c(Cl)c4)c3)nc12 |
| InChI | InChI=1S/C24H12Cl2F3N/c25-20-11-9-16(14-21(20)26)8-7-15-3-1-5-18(13-15)22-12-10-17-4-2-6-19(23(17)30-22)24(27,28)29/h1-6,9-14H |
| InChIKey | KPCJYUFEJUWZOZ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|