C13H10F3NO — CID 101096730
2-[(2S,3S)-3-methyloxiran-2-yl]-8-(trifluoromethyl)quinoline (PubChem CID 101096730) has the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-[(2S,3S)-3-methyloxiran-2-yl]-8-(trifluoromethyl)quinoline.
| Compound Name | 2-[(2S,3S)-3-methyloxiran-2-yl]-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 101096730 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-[(2S,3S)-3-methyloxiran-2-yl]-8-(trifluoromethyl)quinoline |
| SMILES | C[C@@H]1O[C@H]1c1ccc2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C13H10F3NO/c1-7-12(18-7)10-6-5-8-3-2-4-9(11(8)17-10)13(14,15)16/h2-7,12H,1H3/t7-,12+/m0/s1 |
| InChIKey | FMULFSQZCBEWLB-JVXZTZIISA-N |
| XLogP | 3.71 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|