C6H2F8 — CID 87288466
1,1,1,4,4,5,5,6-octafluorohex-2-yne (PubChem CID 87288466) has the molecular formula C6H2F8 and a molecular weight of 226.07 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,6-octafluorohex-2-yne.
| Compound Name | 1,1,1,4,4,5,5,6-octafluorohex-2-yne |
|---|---|
| PubChem CID | 87288466 |
| Molecular Formula | C6H2F8 |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 1,1,1,4,4,5,5,6-octafluorohex-2-yne |
| SMILES | FCC(F)(F)C(F)(F)C#CC(F)(F)F |
| InChI | InChI=1S/C6H2F8/c7-3-5(10,11)4(8,9)1-2-6(12,13)14/h3H2 |
| InChIKey | ADGNTAHQPILZCQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|