C18H32F6NiP2 — CID 11016358
2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;1,1,1,4,4,4-hexafluorobut-2-yne;nickel (PubChem CID 11016358) has the molecular formula C18H32F6NiP2 and a molecular weight of 483.08 g/mol. Its IUPAC name is 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;1,1,1,4,4,4-hexafluorobut-2-yne;nickel.
| Compound Name | 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;1,1,1,4,4,4-hexafluorobut-2-yne;nickel |
|---|---|
| PubChem CID | 11016358 |
| Molecular Formula | C18H32F6NiP2 |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;1,1,1,4,4,4-hexafluorobut-2-yne;nickel |
| SMILES | CC(C)P(CCP(C(C)C)C(C)C)C(C)C.FC(F)(F)C#CC(F)(F)F.[Ni] |
| InChI | InChI=1S/C14H32P2.C4F6.Ni/c1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8;5-3(6,7)1-2-4(8,9)10;/h11-14H,9-10H2,1-8H3;; |
| InChIKey | JARVMYLZFCHETC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|