About 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium
2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium (PubChem CID 15876186) has the molecular formula C16H36P2Pd
and a molecular weight of 396.83 g/mol. Its IUPAC name is 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium.
Molecular Properties
| Compound Name | 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium |
| PubChem CID | 15876186 |
| Molecular Formula | C16H36P2Pd |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium |
| SMILES | C=C.CC(C)P(CCP(C(C)C)C(C)C)C(C)C.[Pd] |
| InChI | InChI=1S/C14H32P2.C2H4.Pd/c1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8;1-2;/h11-14H,9-10H2,1-8H3;1-2H2; |
| InChIKey | SXWDGXJOKQELNJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium?
The IUPAC name of 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium (CID 15876186) is 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium.
What is the SMILES notation for 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium?
The canonical SMILES for 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium is C=C.CC(C)P(CCP(C(C)C)C(C)C)C(C)C.[Pd].
What is the InChIKey of 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium?
The InChIKey is SXWDGXJOKQELNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32P2.C2H4.Pd/c1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8;1-2;/h11-14H,9-10H2,1-8H3;1-2H2;.
What are the key properties of 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium?
2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium has a molecular weight of 396.83 g/mol, XLogP of 6.38, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;ethene;palladium is sourced from PubChem (CID 15876186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).