C10H24NP — CID 547402
2-di(propan-2-yl)phosphanyl-N,N-dimethylethanamine (PubChem CID 547402) has the molecular formula C10H24NP and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-di(propan-2-yl)phosphanyl-N,N-dimethylethanamine.
| Compound Name | 2-di(propan-2-yl)phosphanyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 547402 |
| Molecular Formula | C10H24NP |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | 2-di(propan-2-yl)phosphanyl-N,N-dimethylethanamine |
| SMILES | CC(C)P(CCN(C)C)C(C)C |
| InChI | InChI=1S/C10H24NP/c1-9(2)12(10(3)4)8-7-11(5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | AZFJAHWTVGNCLM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|