C7H6F6O2 — CID 140706155
2-ethoxy-1,1,1,5,5,5-hexafluoropent-3-yn-2-ol (PubChem CID 140706155) has the molecular formula C7H6F6O2 and a molecular weight of 236.11 g/mol. Its IUPAC name is 2-ethoxy-1,1,1,5,5,5-hexafluoropent-3-yn-2-ol.
| Compound Name | 2-ethoxy-1,1,1,5,5,5-hexafluoropent-3-yn-2-ol |
|---|---|
| PubChem CID | 140706155 |
| Molecular Formula | C7H6F6O2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-ethoxy-1,1,1,5,5,5-hexafluoropent-3-yn-2-ol |
| SMILES | CCOC(O)(C#CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O2/c1-2-15-5(14,7(11,12)13)3-4-6(8,9)10/h14H,2H2,1H3 |
| InChIKey | FZKXPCTWFSXIDL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|