C3F8S — CID 23237448
pentafluoro(3,3,3-trifluoroprop-1-ynyl)-λ6-sulfane (PubChem CID 23237448) has the molecular formula C3F8S and a molecular weight of 220.08 g/mol. Its IUPAC name is pentafluoro(3,3,3-trifluoroprop-1-ynyl)-λ6-sulfane.
| Compound Name | pentafluoro(3,3,3-trifluoroprop-1-ynyl)-λ6-sulfane |
|---|---|
| PubChem CID | 23237448 |
| Molecular Formula | C3F8S |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | pentafluoro(3,3,3-trifluoroprop-1-ynyl)-λ6-sulfane |
| SMILES | FC(F)(F)C#CS(F)(F)(F)(F)F |
| InChI | InChI=1S/C3F8S/c4-3(5,6)1-2-12(7,8,9,10)11 |
| InChIKey | ONTRXDRGTGEVBC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|