C12H5F13O — CID 23237892
7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododeca-3,5-diyn-1-ol (PubChem CID 23237892) has the molecular formula C12H5F13O and a molecular weight of 412.15 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododeca-3,5-diyn-1-ol.
| Compound Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododeca-3,5-diyn-1-ol |
|---|---|
| PubChem CID | 23237892 |
| Molecular Formula | C12H5F13O |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododeca-3,5-diyn-1-ol |
| SMILES | OCCC#CC#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F13O/c13-7(14,5-3-1-2-4-6-26)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h26H,4,6H2 |
| InChIKey | LOBCLSNLXLTPSW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|