C8H5F15Si — CID 158035981
ethyl-fluoro-bis(1,1,2,2,3,3,3-heptafluoropropyl)silane (PubChem CID 158035981) has the molecular formula C8H5F15Si and a molecular weight of 414.18 g/mol. Its IUPAC name is ethyl-fluoro-bis(1,1,2,2,3,3,3-heptafluoropropyl)silane.
| Compound Name | ethyl-fluoro-bis(1,1,2,2,3,3,3-heptafluoropropyl)silane |
|---|---|
| PubChem CID | 158035981 |
| Molecular Formula | C8H5F15Si |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | ethyl-fluoro-bis(1,1,2,2,3,3,3-heptafluoropropyl)silane |
| SMILES | CC[Si](F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F15Si/c1-2-24(23,7(19,20)3(9,10)5(13,14)15)8(21,22)4(11,12)6(16,17)18/h2H2,1H3 |
| InChIKey | FHTBVLLIVQJVFY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|