C5H10F7N3Si — CID 151582040
N-[diamino(ethyl)silyl]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 151582040) has the molecular formula C5H10F7N3Si and a molecular weight of 273.23 g/mol. Its IUPAC name is N-[diamino(ethyl)silyl]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[diamino(ethyl)silyl]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 151582040 |
| Molecular Formula | C5H10F7N3Si |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-[diamino(ethyl)silyl]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CC[Si](N)(N)NC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H10F7N3Si/c1-2-16(13,14)15-5(11,12)3(6,7)4(8,9)10/h15H,2,13-14H2,1H3 |
| InChIKey | QGRWGKBYXXURDP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|