C10H7F16N — CID 71510831
2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-4-methylnonan-1-amine (PubChem CID 71510831) has the molecular formula C10H7F16N and a molecular weight of 445.14 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-4-methylnonan-1-amine.
| Compound Name | 2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-4-methylnonan-1-amine |
|---|---|
| PubChem CID | 71510831 |
| Molecular Formula | C10H7F16N |
| Molecular Weight | 445.14 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluoro-4-methylnonan-1-amine |
| SMILES | CC(F)(C(F)(F)C(F)(F)CN)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F16N/c1-3(11,5(14,15)4(12,13)2-27)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)26/h2,27H2,1H3 |
| InChIKey | YAQWZMSWRAHEKV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|