C17H17F21O5Si — CID 175540344
ethyl acetate;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(trimethoxy)silane (PubChem CID 175540344) has the molecular formula C17H17F21O5Si and a molecular weight of 728.36 g/mol. Its IUPAC name is ethyl acetate;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(trimethoxy)silane.
| Compound Name | ethyl acetate;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(trimethoxy)silane |
|---|---|
| PubChem CID | 175540344 |
| Molecular Formula | C17H17F21O5Si |
| Molecular Weight | 728.36 g/mol |
| Exact Mass | 728.05 |
| IUPAC Name | ethyl acetate;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl(trimethoxy)silane |
| SMILES | CCOC(C)=O.CO[Si](OC)(OC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F21O3Si.C4H8O2/c1-35-38(36-2,37-3)13(33,34)11(28,29)9(24,25)7(20,21)5(16,17)4(14,15)6(18,19)8(22,23)10(26,27)12(30,31)32;1-3-6-4(2)5/h1-3H3;3H2,1-2H3 |
| InChIKey | YNNISIRDMVGZHZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.36 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|