C5H4F8O3S — CID 134187116
1,1,2,3,3,4,4,4-octafluoro-2-methylbutane-1-sulfonic acid (PubChem CID 134187116) has the molecular formula C5H4F8O3S and a molecular weight of 296.14 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,4-octafluoro-2-methylbutane-1-sulfonic acid.
| Compound Name | 1,1,2,3,3,4,4,4-octafluoro-2-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 134187116 |
| Molecular Formula | C5H4F8O3S |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 1,1,2,3,3,4,4,4-octafluoro-2-methylbutane-1-sulfonic acid |
| SMILES | CC(F)(C(F)(F)C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C5H4F8O3S/c1-2(6,3(7,8)4(9,10)11)5(12,13)17(14,15)16/h1H3,(H,14,15,16) |
| InChIKey | YJFGODOUXFENCQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|