C8H9F10N — CID 19761920
1,1,2,3,3,4,4,5,5,5-decafluoro-N,N,2-trimethylpentan-1-amine (PubChem CID 19761920) has the molecular formula C8H9F10N and a molecular weight of 309.15 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,5-decafluoro-N,N,2-trimethylpentan-1-amine.
| Compound Name | 1,1,2,3,3,4,4,5,5,5-decafluoro-N,N,2-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 19761920 |
| Molecular Formula | C8H9F10N |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,5-decafluoro-N,N,2-trimethylpentan-1-amine |
| SMILES | CN(C)C(F)(F)C(C)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F10N/c1-4(9,8(17,18)19(2)3)5(10,11)6(12,13)7(14,15)16/h1-3H3 |
| InChIKey | SIBNLQIUSPQBRK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|