C19H24F16O6 — CID 175826701
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]decan-1-ol (PubChem CID 175826701) has the molecular formula C19H24F16O6 and a molecular weight of 652.36 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]decan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]decan-1-ol |
|---|---|
| PubChem CID | 175826701 |
| Molecular Formula | C19H24F16O6 |
| Molecular Weight | 652.36 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-10-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]decan-1-ol |
| SMILES | COCCOCCOCCOCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C19H24F16O6/c1-37-2-3-38-4-5-39-6-7-40-8-9-41-11-13(22,23)15(26,27)17(30,31)19(34,35)18(32,33)16(28,29)14(24,25)12(20,21)10-36/h36H,2-11H2,1H3 |
| InChIKey | PGAUUQVPMIZFLE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|