C12H12F8O6-2 — CID 53400248
2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol;bis(prop-2-enoate) (PubChem CID 53400248) has the molecular formula C12H12F8O6-2 and a molecular weight of 404.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol;bis(prop-2-enoate).
| Compound Name | 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol;bis(prop-2-enoate) |
|---|---|
| PubChem CID | 53400248 |
| Molecular Formula | C12H12F8O6-2 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol;bis(prop-2-enoate) |
| SMILES | C=CC(=O)[O-].C=CC(=O)[O-].OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C6H6F8O2.2C3H4O2/c7-3(8,1-15)5(11,12)6(13,14)4(9,10)2-16;2*1-2-3(4)5/h15-16H,1-2H2;2*2H,1H2,(H,4,5)/p-2 |
| InChIKey | FGSMZPBDFSGXTR-UHFFFAOYSA-L |
| XLogP | -0.64 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|