C26H19Cl3F8N2O4 — CID 102093489
3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro-N-[4-(hexanoylamino)-9,10-dioxoanthracen-1-yl]hexanamide (PubChem CID 102093489) has the molecular formula C26H19Cl3F8N2O4 and a molecular weight of 681.79 g/mol. Its IUPAC name is 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro-N-[4-(hexanoylamino)-9,10-dioxoanthracen-1-yl]hexanamide.
| Compound Name | 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro-N-[4-(hexanoylamino)-9,10-dioxoanthracen-1-yl]hexanamide |
|---|---|
| PubChem CID | 102093489 |
| Molecular Formula | C26H19Cl3F8N2O4 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 680.03 |
| IUPAC Name | 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluoro-N-[4-(hexanoylamino)-9,10-dioxoanthracen-1-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(NC(=O)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H19Cl3F8N2O4/c1-2-3-4-9-16(40)38-14-10-11-15(18-17(14)19(41)12-7-5-6-8-13(12)20(18)42)39-21(43)22(30,31)23(27,32)25(34,35)24(28,33)26(29,36)37/h5-8,10-11H,2-4,9H2,1H3,(H,38,40)(H,39,43) |
| InChIKey | PMKWZGGKHDSUMN-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|