C30H36N4O6 — CID 91745988
N-[4,5,8-tris(butanoylamino)-9,10-dioxoanthracen-1-yl]butanamide (PubChem CID 91745988) has the molecular formula C30H36N4O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is N-[4,5,8-tris(butanoylamino)-9,10-dioxoanthracen-1-yl]butanamide.
| Compound Name | N-[4,5,8-tris(butanoylamino)-9,10-dioxoanthracen-1-yl]butanamide |
|---|---|
| PubChem CID | 91745988 |
| Molecular Formula | C30H36N4O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | N-[4,5,8-tris(butanoylamino)-9,10-dioxoanthracen-1-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)CCC)c2c1C(=O)c1c(NC(=O)CCC)ccc(NC(=O)CCC)c1C2=O |
| InChI | InChI=1S/C30H36N4O6/c1-5-9-21(35)31-17-13-14-18(32-22(36)10-6-2)26-25(17)29(39)27-19(33-23(37)11-7-3)15-16-20(28(27)30(26)40)34-24(38)12-8-4/h13-16H,5-12H2,1-4H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | LTLPFPOPSRJHAZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|