C10H5F15O — CID 118205586
4,5,5,6,6,7,7,7-octafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-one (PubChem CID 118205586) has the molecular formula C10H5F15O and a molecular weight of 426.12 g/mol. Its IUPAC name is 4,5,5,6,6,7,7,7-octafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-one.
| Compound Name | 4,5,5,6,6,7,7,7-octafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-one |
|---|---|
| PubChem CID | 118205586 |
| Molecular Formula | C10H5F15O |
| Molecular Weight | 426.12 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 4,5,5,6,6,7,7,7-octafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-one |
| SMILES | CCC(=O)C(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15O/c1-2-3(26)4(11,5(12,8(17,18)19)9(20,21)22)6(13,14)7(15,16)10(23,24)25/h2H2,1H3 |
| InChIKey | MJGRQUHZWKAJIM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|