C10H9F9O2 — CID 175341912
3-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-methylhept-2-enoic acid (PubChem CID 175341912) has the molecular formula C10H9F9O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is 3-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-methylhept-2-enoic acid.
| Compound Name | 3-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 175341912 |
| Molecular Formula | C10H9F9O2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-methylhept-2-enoic acid |
| SMILES | CCC(=C(C)C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F9O2/c1-3-5(4(2)6(20)21)7(11,12)8(13,14)9(15,16)10(17,18)19/h3H2,1-2H3,(H,20,21) |
| InChIKey | WMSHRAVRZKRXTP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|