C13H8ClF15O2 — CID 150733821
2-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-propyldec-2-enoic acid (PubChem CID 150733821) has the molecular formula C13H8ClF15O2 and a molecular weight of 516.63 g/mol. Its IUPAC name is 2-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-propyldec-2-enoic acid.
| Compound Name | 2-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-propyldec-2-enoic acid |
|---|---|
| PubChem CID | 150733821 |
| Molecular Formula | C13H8ClF15O2 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 2-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-propyldec-2-enoic acid |
| SMILES | CCCC(=C(Cl)C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF15O2/c1-2-3-4(5(14)6(30)31)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)29/h2-3H2,1H3,(H,30,31) |
| InChIKey | JSKCZQMXOWGJGH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|