C7Cl2F12O — CID 87882096
1,2-dichloro-1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pentane (PubChem CID 87882096) has the molecular formula C7Cl2F12O and a molecular weight of 398.96 g/mol. Its IUPAC name is 1,2-dichloro-1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pentane.
| Compound Name | 1,2-dichloro-1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pentane |
|---|---|
| PubChem CID | 87882096 |
| Molecular Formula | C7Cl2F12O |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 397.91 |
| IUPAC Name | 1,2-dichloro-1,1,2,3,3,4,5,5,5-nonafluoro-4-(1,2,2-trifluoroethenoxy)pentane |
| SMILES | FC(F)=C(F)OC(F)(C(F)(F)F)C(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C7Cl2F12O/c8-3(13,6(9,17)18)4(14,15)5(16,7(19,20)21)22-2(12)1(10)11 |
| InChIKey | XZQOCQOYURIKHR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|