C8H10F6S2 — CID 10379130
1,1-bis(ethylsulfanyl)-2,3,3,4,4,4-hexafluorobut-1-ene (PubChem CID 10379130) has the molecular formula C8H10F6S2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 1,1-bis(ethylsulfanyl)-2,3,3,4,4,4-hexafluorobut-1-ene.
| Compound Name | 1,1-bis(ethylsulfanyl)-2,3,3,4,4,4-hexafluorobut-1-ene |
|---|---|
| PubChem CID | 10379130 |
| Molecular Formula | C8H10F6S2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1,1-bis(ethylsulfanyl)-2,3,3,4,4,4-hexafluorobut-1-ene |
| SMILES | CCSC(SCC)=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6S2/c1-3-15-6(16-4-2)5(9)7(10,11)8(12,13)14/h3-4H2,1-2H3 |
| InChIKey | BTSVADGGHXXSGY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|