C12H17F3O2S2 — CID 102573472
(3E)-6,6-bis(ethylsulfanyl)-3-methyl-5-(trifluoromethyl)hexa-3,5-dienoic acid (PubChem CID 102573472) has the molecular formula C12H17F3O2S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (3E)-6,6-bis(ethylsulfanyl)-3-methyl-5-(trifluoromethyl)hexa-3,5-dienoic acid.
| Compound Name | (3E)-6,6-bis(ethylsulfanyl)-3-methyl-5-(trifluoromethyl)hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 102573472 |
| Molecular Formula | C12H17F3O2S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (3E)-6,6-bis(ethylsulfanyl)-3-methyl-5-(trifluoromethyl)hexa-3,5-dienoic acid |
| SMILES | CCSC(SCC)=C(/C=C(\C)CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O2S2/c1-4-18-11(19-5-2)9(12(13,14)15)6-8(3)7-10(16)17/h6H,4-5,7H2,1-3H3,(H,16,17)/b8-6+ |
| InChIKey | ZIPNFUXOVJNRCJ-SOFGYWHQSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|