C6H5F7 — CID 76545614
1,1,1,2,2,3,4-heptafluorohex-3-ene (PubChem CID 76545614) has the molecular formula C6H5F7 and a molecular weight of 210.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,4-heptafluorohex-3-ene.
| Compound Name | 1,1,1,2,2,3,4-heptafluorohex-3-ene |
|---|---|
| PubChem CID | 76545614 |
| Molecular Formula | C6H5F7 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 1,1,1,2,2,3,4-heptafluorohex-3-ene |
| SMILES | CCC(F)=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7/c1-2-3(7)4(8)5(9,10)6(11,12)13/h2H2,1H3 |
| InChIKey | QAQXDIFHMWHZAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|