C12F24 — CID 166521314
(Z)-1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)non-3-ene (PubChem CID 166521314) has the molecular formula C12F24 and a molecular weight of 600.08 g/mol. Its IUPAC name is (Z)-1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)non-3-ene.
| Compound Name | (Z)-1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)non-3-ene |
|---|---|
| PubChem CID | 166521314 |
| Molecular Formula | C12F24 |
| Molecular Weight | 600.08 g/mol |
| Exact Mass | 599.96 |
| IUPAC Name | (Z)-1,1,1,2,2,3,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)non-3-ene |
| SMILES | F/C(=C(\C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F24/c13-2(5(18,19)10(28,29)30)1(4(16,17)7(22,23)11(31,32)33)3(14,15)6(20,21)8(24,25)9(26,27)12(34,35)36/b2-1- |
| InChIKey | YVWDUSJACSEOLP-UPHRSURJSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.08 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|