C12F22 — CID 175349151
1,1,1,2,2,4,5,6,7,7,8,8,9,9,9-pentadecafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)nona-3,5-diene (PubChem CID 175349151) has the molecular formula C12F22 and a molecular weight of 562.09 g/mol. Its IUPAC name is 1,1,1,2,2,4,5,6,7,7,8,8,9,9,9-pentadecafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)nona-3,5-diene.
| Compound Name | 1,1,1,2,2,4,5,6,7,7,8,8,9,9,9-pentadecafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)nona-3,5-diene |
|---|---|
| PubChem CID | 175349151 |
| Molecular Formula | C12F22 |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.96 |
| IUPAC Name | 1,1,1,2,2,4,5,6,7,7,8,8,9,9,9-pentadecafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)nona-3,5-diene |
| SMILES | FC(C(F)=C(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F22/c13-1(2(14)4(15)7(19,20)8(21,22)12(32,33)34)3(6(17,18)11(29,30)31)5(16,9(23,24)25)10(26,27)28 |
| InChIKey | CIJKPQZDMCOEQZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|