C9H10ClF7S — CID 102096238
(Z)-1-butylsulfanyl-1-chloro-2,3,3,4,4,5,5-heptafluoropent-1-ene (PubChem CID 102096238) has the molecular formula C9H10ClF7S and a molecular weight of 318.69 g/mol. Its IUPAC name is (Z)-1-butylsulfanyl-1-chloro-2,3,3,4,4,5,5-heptafluoropent-1-ene.
| Compound Name | (Z)-1-butylsulfanyl-1-chloro-2,3,3,4,4,5,5-heptafluoropent-1-ene |
|---|---|
| PubChem CID | 102096238 |
| Molecular Formula | C9H10ClF7S |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (Z)-1-butylsulfanyl-1-chloro-2,3,3,4,4,5,5-heptafluoropent-1-ene |
| SMILES | CCCCS/C(Cl)=C(/F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H10ClF7S/c1-2-3-4-18-6(10)5(11)8(14,15)9(16,17)7(12)13/h7H,2-4H2,1H3/b6-5+ |
| InChIKey | FGDMYMOPWWCSOT-AATRIKPKSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|