C8H10F6 — CID 174975594
3-(difluoromethyl)-1,1,1,2-tetrafluorohept-2-ene (PubChem CID 174975594) has the molecular formula C8H10F6 and a molecular weight of 220.16 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,1,1,2-tetrafluorohept-2-ene.
| Compound Name | 3-(difluoromethyl)-1,1,1,2-tetrafluorohept-2-ene |
|---|---|
| PubChem CID | 174975594 |
| Molecular Formula | C8H10F6 |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-(difluoromethyl)-1,1,1,2-tetrafluorohept-2-ene |
| SMILES | CCCCC(=C(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C8H10F6/c1-2-3-4-5(7(10)11)6(9)8(12,13)14/h7H,2-4H2,1H3 |
| InChIKey | UUIBIMIOTHGKFG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |